C21H20F3N5O3 — CID 52919149
1-[5-[4-[(3-hydroxypropylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea (PubChem CID 52919149) has the molecular formula C21H20F3N5O3 and a molecular weight of 447.42 g/mol. Its IUPAC name is 1-[5-[4-[(3-hydroxypropylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea.
| Compound Name | 1-[5-[4-[(3-hydroxypropylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 52919149 |
| Molecular Formula | C21H20F3N5O3 |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 1-[5-[4-[(3-hydroxypropylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea |
| SMILES | O=C(Nc1ncc(-c2ccc(CNCCCO)cc2)c(=O)[nH]1)Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H20F3N5O3/c22-15-8-17(24)18(9-16(15)23)27-21(32)29-20-26-11-14(19(31)28-20)13-4-2-12(3-5-13)10-25-6-1-7-30/h2-5,8-9,11,25,30H,1,6-7,10H2,(H3,26,27,28,29,31,32) |
| InChIKey | BNGOJOAPWJKONS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|