C26H29F3N6O2 — CID 52919270
1-[5-[4-[[3-aminopropyl(3-methylbut-2-enyl)amino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea (PubChem CID 52919270) has the molecular formula C26H29F3N6O2 and a molecular weight of 514.55 g/mol. Its IUPAC name is 1-[5-[4-[[3-aminopropyl(3-methylbut-2-enyl)amino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea.
| Compound Name | 1-[5-[4-[[3-aminopropyl(3-methylbut-2-enyl)amino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 52919270 |
| Molecular Formula | C26H29F3N6O2 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 1-[5-[4-[[3-aminopropyl(3-methylbut-2-enyl)amino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea |
| SMILES | CC(C)=CCN(CCCN)Cc1ccc(-c2cnc(NC(=O)Nc3cc(F)c(F)cc3F)[nH]c2=O)cc1 |
| InChI | InChI=1S/C26H29F3N6O2/c1-16(2)8-11-35(10-3-9-30)15-17-4-6-18(7-5-17)19-14-31-25(33-24(19)36)34-26(37)32-23-13-21(28)20(27)12-22(23)29/h4-8,12-14H,3,9-11,15,30H2,1-2H3,(H3,31,32,33,34,36,37) |
| InChIKey | GNTBZFPLAHVURI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|