C22H20F3N5O4 — CID 52919274
4-[[4-[6-oxo-2-[(2,4,5-trifluorophenyl)carbamoylamino]-1H-pyrimidin-5-yl]phenyl]methylamino]butanoic acid (PubChem CID 52919274) has the molecular formula C22H20F3N5O4 and a molecular weight of 475.43 g/mol. Its IUPAC name is 4-[[4-[6-oxo-2-[(2,4,5-trifluorophenyl)carbamoylamino]-1H-pyrimidin-5-yl]phenyl]methylamino]butanoic acid.
| Compound Name | 4-[[4-[6-oxo-2-[(2,4,5-trifluorophenyl)carbamoylamino]-1H-pyrimidin-5-yl]phenyl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 52919274 |
| Molecular Formula | C22H20F3N5O4 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 4-[[4-[6-oxo-2-[(2,4,5-trifluorophenyl)carbamoylamino]-1H-pyrimidin-5-yl]phenyl]methylamino]butanoic acid |
| SMILES | O=C(O)CCCNCc1ccc(-c2cnc(NC(=O)Nc3cc(F)c(F)cc3F)[nH]c2=O)cc1 |
| InChI | InChI=1S/C22H20F3N5O4/c23-15-8-17(25)18(9-16(15)24)28-22(34)30-21-27-11-14(20(33)29-21)13-5-3-12(4-6-13)10-26-7-1-2-19(31)32/h3-6,8-9,11,26H,1-2,7,10H2,(H,31,32)(H3,27,28,29,30,33,34) |
| InChIKey | AEYNHKQJOILKMC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 136.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|