C20H37N11O4 — CID 52919539
(3S)-N-[2-(carbamoylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl]-6-(diaminomethylideneamino)-N-methyl-3-(3-piperazin-1-ylpropanoylamino)hexanamide (PubChem CID 52919539) has the molecular formula C20H37N11O4 and a molecular weight of 495.59 g/mol. Its IUPAC name is (3S)-N-[2-(carbamoylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl]-6-(diaminomethylideneamino)-N-methyl-3-(3-piperazin-1-ylpropanoylamino)hexanamide.
| Compound Name | (3S)-N-[2-(carbamoylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl]-6-(diaminomethylideneamino)-N-methyl-3-(3-piperazin-1-ylpropanoylamino)hexanamide |
|---|---|
| PubChem CID | 52919539 |
| Molecular Formula | C20H37N11O4 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | (3S)-N-[2-(carbamoylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl]-6-(diaminomethylideneamino)-N-methyl-3-(3-piperazin-1-ylpropanoylamino)hexanamide |
| SMILES | CN(C(=O)C[C@H](CCCN=C(N)N)NC(=O)CCN1CCNCC1)C1CN=C(NC(N)=O)NC1=O |
| InChI | InChI=1S/C20H37N11O4/c1-30(14-12-26-20(28-17(14)34)29-19(23)35)16(33)11-13(3-2-5-25-18(21)22)27-15(32)4-8-31-9-6-24-7-10-31/h13-14,24H,2-12H2,1H3,(H,27,32)(H4,21,22,25)(H4,23,26,28,29,34,35)/t13-,14?/m0/s1 |
| InChIKey | JVZREVIOJPJYPN-LSLKUGRBSA-N |
| XLogP | -3.81 |
| TPSA | 225.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | -3.81 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|