C17H10F8N2O3 — CID 52920644
2,6-difluoro-N-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]carbamoyl]benzamide (PubChem CID 52920644) has the molecular formula C17H10F8N2O3 and a molecular weight of 442.26 g/mol. Its IUPAC name is 2,6-difluoro-N-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]carbamoyl]benzamide.
| Compound Name | 2,6-difluoro-N-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 52920644 |
| Molecular Formula | C17H10F8N2O3 |
| Molecular Weight | 442.26 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 2,6-difluoro-N-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Nc1ccc(OC(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H10F8N2O3/c18-10-2-1-3-11(19)12(10)13(28)27-15(29)26-8-4-6-9(7-5-8)30-14(16(20,21)22)17(23,24)25/h1-7,14H,(H2,26,27,28,29) |
| InChIKey | IRXXOYNTRSDNLW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.26 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |