About [(1R,2S)-2-(hydroxymethyl)-3-methylidenecyclopropyl]methanol
[(1R,2S)-2-(hydroxymethyl)-3-methylidenecyclopropyl]methanol (PubChem CID 52920879) has the molecular formula C6H10O2
and a molecular weight of 114.14 g/mol. Its IUPAC name is [(1R,2S)-2-(hydroxymethyl)-3-methylidenecyclopropyl]methanol.
Molecular Properties
| Compound Name | [(1R,2S)-2-(hydroxymethyl)-3-methylidenecyclopropyl]methanol |
| PubChem CID | 52920879 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | [(1R,2S)-2-(hydroxymethyl)-3-methylidenecyclopropyl]methanol |
| SMILES | C=C1[C@@H](CO)[C@H]1CO |
| InChI | InChI=1S/C6H10O2/c1-4-5(2-7)6(4)3-8/h5-8H,1-3H2/t5-,6+ |
| InChIKey | SUAJNHGXHTVCFN-OLQVQODUSA-N |
| XLogP | -0.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2S)-2-(hydroxymethyl)-3-methylidenecyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-2-(hydroxymethyl)-3-methylidenecyclopropyl]methanol?
The IUPAC name of [(1R,2S)-2-(hydroxymethyl)-3-methylidenecyclopropyl]methanol (CID 52920879) is [(1R,2S)-2-(hydroxymethyl)-3-methylidenecyclopropyl]methanol.
What is the SMILES notation for [(1R,2S)-2-(hydroxymethyl)-3-methylidenecyclopropyl]methanol?
The canonical SMILES for [(1R,2S)-2-(hydroxymethyl)-3-methylidenecyclopropyl]methanol is C=C1[C@@H](CO)[C@H]1CO.
What is the InChIKey of [(1R,2S)-2-(hydroxymethyl)-3-methylidenecyclopropyl]methanol?
The InChIKey is SUAJNHGXHTVCFN-OLQVQODUSA-N. The full InChI is InChI=1S/C6H10O2/c1-4-5(2-7)6(4)3-8/h5-8H,1-3H2/t5-,6+.
What are the key properties of [(1R,2S)-2-(hydroxymethyl)-3-methylidenecyclopropyl]methanol?
[(1R,2S)-2-(hydroxymethyl)-3-methylidenecyclopropyl]methanol has a molecular weight of 114.14 g/mol, XLogP of -0.23, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-2-(hydroxymethyl)-3-methylidenecyclopropyl]methanol is sourced from PubChem (CID 52920879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).