C22H19F6NO5 — CID 52920923
4-butyl-11-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-7-methoxy-[1,3]dioxolo[4,5-c]phenanthridin-5-one (PubChem CID 52920923) has the molecular formula C22H19F6NO5 and a molecular weight of 491.38 g/mol. Its IUPAC name is 4-butyl-11-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-7-methoxy-[1,3]dioxolo[4,5-c]phenanthridin-5-one.
| Compound Name | 4-butyl-11-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-7-methoxy-[1,3]dioxolo[4,5-c]phenanthridin-5-one |
|---|---|
| PubChem CID | 52920923 |
| Molecular Formula | C22H19F6NO5 |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 4-butyl-11-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-7-methoxy-[1,3]dioxolo[4,5-c]phenanthridin-5-one |
| SMILES | CCCCn1c(=O)c2cc(OC)ccc2c2cc(C(O)(C(F)(F)F)C(F)(F)F)c3c(c21)OCO3 |
| InChI | InChI=1S/C22H19F6NO5/c1-3-4-7-29-16-13(12-6-5-11(32-2)8-14(12)19(29)30)9-15(17-18(16)34-10-33-17)20(31,21(23,24)25)22(26,27)28/h5-6,8-9,31H,3-4,7,10H2,1-2H3 |
| InChIKey | ASGVPLYYNNLNHE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|