C21H17F6NO4 — CID 52920924
4-butyl-11-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-[1,3]dioxolo[4,5-c]phenanthridin-5-one (PubChem CID 52920924) has the molecular formula C21H17F6NO4 and a molecular weight of 461.36 g/mol. Its IUPAC name is 4-butyl-11-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-[1,3]dioxolo[4,5-c]phenanthridin-5-one.
| Compound Name | 4-butyl-11-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-[1,3]dioxolo[4,5-c]phenanthridin-5-one |
|---|---|
| PubChem CID | 52920924 |
| Molecular Formula | C21H17F6NO4 |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 4-butyl-11-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-[1,3]dioxolo[4,5-c]phenanthridin-5-one |
| SMILES | CCCCn1c(=O)c2ccccc2c2cc(C(O)(C(F)(F)F)C(F)(F)F)c3c(c21)OCO3 |
| InChI | InChI=1S/C21H17F6NO4/c1-2-3-8-28-15-13(11-6-4-5-7-12(11)18(28)29)9-14(16-17(15)32-10-31-16)19(30,20(22,23)24)21(25,26)27/h4-7,9,30H,2-3,8,10H2,1H3 |
| InChIKey | ZXJODVSHXJLGQG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|