C21H34N2O2 — CID 52921551
[(2E)-3,7-dimethylocta-2,6-dienyl] 1-tert-butyl-3-propan-2-ylpyrazole-5-carboxylate (PubChem CID 52921551) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] 1-tert-butyl-3-propan-2-ylpyrazole-5-carboxylate.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 1-tert-butyl-3-propan-2-ylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 52921551 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 1-tert-butyl-3-propan-2-ylpyrazole-5-carboxylate |
| SMILES | CC(C)=CCC/C(C)=C/COC(=O)c1cc(C(C)C)nn1C(C)(C)C |
| InChI | InChI=1S/C21H34N2O2/c1-15(2)10-9-11-17(5)12-13-25-20(24)19-14-18(16(3)4)22-23(19)21(6,7)8/h10,12,14,16H,9,11,13H2,1-8H3/b17-12+ |
| InChIKey | VILDBNRLFYLAMS-SFQUDFHCSA-N |
| XLogP | 5.61 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|