C36H34N2O3 — CID 52921716
2-[4-[[5-[[(1S)-1-(3-cyclopropylphenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 52921716) has the molecular formula C36H34N2O3 and a molecular weight of 542.68 g/mol. Its IUPAC name is 2-[4-[[5-[[(1S)-1-(3-cyclopropylphenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[5-[[(1S)-1-(3-cyclopropylphenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 52921716 |
| Molecular Formula | C36H34N2O3 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | 2-[4-[[5-[[(1S)-1-(3-cyclopropylphenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)O)cc2)c2ccc(C(=O)N[C@@H](C)c3cccc(C4CC4)c3)cc12 |
| InChI | InChI=1S/C36H34N2O3/c1-22-24(3)38(21-25-11-13-27(14-12-25)31-9-4-5-10-32(31)36(40)41)34-18-17-30(20-33(22)34)35(39)37-23(2)28-7-6-8-29(19-28)26-15-16-26/h4-14,17-20,23,26H,15-16,21H2,1-3H3,(H,37,39)(H,40,41)/t23-/m0/s1 |
| InChIKey | WFYZRGARXVIIQQ-QHCPKHFHSA-N |
| XLogP | 8.04 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|