C29H27F6N3O — CID 52921718
1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-(1H-indol-6-ylmethyl)piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol (PubChem CID 52921718) has the molecular formula C29H27F6N3O and a molecular weight of 547.54 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-(1H-indol-6-ylmethyl)piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-(1H-indol-6-ylmethyl)piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 52921718 |
| Molecular Formula | C29H27F6N3O |
| Molecular Weight | 547.54 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-(1H-indol-6-ylmethyl)piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol |
| SMILES | OC(c1ccc(-c2ccc(CN3CCN(Cc4ccc5cc[nH]c5c4)CC3)cc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C29H27F6N3O/c30-28(31,32)27(39,29(33,34)35)25-9-7-23(8-10-25)22-4-1-20(2-5-22)18-37-13-15-38(16-14-37)19-21-3-6-24-11-12-36-26(24)17-21/h1-12,17,36,39H,13-16,18-19H2 |
| InChIKey | UZPXSQGEYPIMGS-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 42.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.54 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |