C20H28O3 — CID 52921958
(5Z,8E,10Z)-10-[(5S)-4-oxo-5-pentylcyclopent-2-en-1-ylidene]deca-5,8-dienoic acid (PubChem CID 52921958) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (5Z,8E,10Z)-10-[(5S)-4-oxo-5-pentylcyclopent-2-en-1-ylidene]deca-5,8-dienoic acid.
| Compound Name | (5Z,8E,10Z)-10-[(5S)-4-oxo-5-pentylcyclopent-2-en-1-ylidene]deca-5,8-dienoic acid |
|---|---|
| PubChem CID | 52921958 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (5Z,8E,10Z)-10-[(5S)-4-oxo-5-pentylcyclopent-2-en-1-ylidene]deca-5,8-dienoic acid |
| SMILES | CCCCC[C@@H]1C(=O)C=C/C1=C/C=C/C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H28O3/c1-2-3-9-13-18-17(15-16-19(18)21)12-10-7-5-4-6-8-11-14-20(22)23/h4,6-7,10,12,15-16,18H,2-3,5,8-9,11,13-14H2,1H3,(H,22,23)/b6-4-,10-7+,17-12-/t18-/m0/s1 |
| InChIKey | JTSWNPYSJJAOQQ-UILHMMCHSA-N |
| XLogP | 5.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|