C26H43NO3 — CID 52922064
(2S,3S)-2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]-3-methylpentanoic acid (PubChem CID 52922064) has the molecular formula C26H43NO3 and a molecular weight of 417.63 g/mol. Its IUPAC name is (2S,3S)-2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 52922064 |
| Molecular Formula | C26H43NO3 |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.32 |
| IUPAC Name | (2S,3S)-2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]-3-methylpentanoic acid |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)N[C@H](C(=O)O)[C@@H](C)CC |
| InChI | InChI=1S/C26H43NO3/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24(28)27-25(26(29)30)23(3)5-2/h9-10,12-13,15-16,18-19,23,25H,4-8,11,14,17,20-22H2,1-3H3,(H,27,28)(H,29,30)/b10-9-,13-12-,16-15-,19-18-/t23-,25-/m0/s1 |
| InChIKey | PDJHDVCMHSOQTA-JIAPQDDQSA-N |
| XLogP | 6.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|