C18H10ClN3O4S2 — CID 5292299
5-chloro-2-[5-[(Z)-[2-imino-4-oxo-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 5292299) has the molecular formula C18H10ClN3O4S2 and a molecular weight of 431.88 g/mol. Its IUPAC name is 5-chloro-2-[5-[(Z)-[2-imino-4-oxo-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 5-chloro-2-[5-[(Z)-[2-imino-4-oxo-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 5292299 |
| Molecular Formula | C18H10ClN3O4S2 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 430.98 |
| IUPAC Name | 5-chloro-2-[5-[(Z)-[2-imino-4-oxo-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(-c3ccc(Cl)cc3C(=O)O)o2)C(=O)N1c1nccs1 |
| InChI | InChI=1S/C18H10ClN3O4S2/c19-9-1-3-11(12(7-9)16(24)25)13-4-2-10(26-13)8-14-15(23)22(17(20)28-14)18-21-5-6-27-18/h1-8,20H,(H,24,25)/b14-8-,20-17- |
| InChIKey | IZWAGKHGHGPIGH-VNGWEAGDSA-N |
| XLogP | 4.81 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|