C19H14F4O4S — CID 5292343
[3-methyl-4-[(E)-1,3,3,3-tetrafluoro-2-methoxycarbonylprop-1-enyl]sulfanylphenyl] benzoate (PubChem CID 5292343) has the molecular formula C19H14F4O4S and a molecular weight of 414.38 g/mol. Its IUPAC name is [3-methyl-4-[(E)-1,3,3,3-tetrafluoro-2-methoxycarbonylprop-1-enyl]sulfanylphenyl] benzoate.
| Compound Name | [3-methyl-4-[(E)-1,3,3,3-tetrafluoro-2-methoxycarbonylprop-1-enyl]sulfanylphenyl] benzoate |
|---|---|
| PubChem CID | 5292343 |
| Molecular Formula | C19H14F4O4S |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | [3-methyl-4-[(E)-1,3,3,3-tetrafluoro-2-methoxycarbonylprop-1-enyl]sulfanylphenyl] benzoate |
| SMILES | COC(=O)/C(=C(/F)Sc1ccc(OC(=O)c2ccccc2)cc1C)C(F)(F)F |
| InChI | InChI=1S/C19H14F4O4S/c1-11-10-13(27-17(24)12-6-4-3-5-7-12)8-9-14(11)28-16(20)15(18(25)26-2)19(21,22)23/h3-10H,1-2H3/b16-15+ |
| InChIKey | DVPPRUYHTYYJMH-FOCLMDBBSA-N |
| XLogP | 5.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|