About 3-oxobutan-2-yl butanoate
3-oxobutan-2-yl butanoate (PubChem CID 529253) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is 3-oxobutan-2-yl butanoate.
Molecular Properties
| Compound Name | 3-oxobutan-2-yl butanoate |
| PubChem CID | 529253 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 3-oxobutan-2-yl butanoate |
| SMILES | CCCC(=O)OC(C)C(C)=O |
| InChI | InChI=1S/C8H14O3/c1-4-5-8(10)11-7(3)6(2)9/h7H,4-5H2,1-3H3 |
| InChIKey | LJDWJXUIGKSETE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-oxobutan-2-yl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxobutan-2-yl butanoate?
The IUPAC name of 3-oxobutan-2-yl butanoate (CID 529253) is 3-oxobutan-2-yl butanoate.
What is the SMILES notation for 3-oxobutan-2-yl butanoate?
The canonical SMILES for 3-oxobutan-2-yl butanoate is CCCC(=O)OC(C)C(C)=O.
What is the InChIKey of 3-oxobutan-2-yl butanoate?
The InChIKey is LJDWJXUIGKSETE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-4-5-8(10)11-7(3)6(2)9/h7H,4-5H2,1-3H3.
What are the key properties of 3-oxobutan-2-yl butanoate?
3-oxobutan-2-yl butanoate has a molecular weight of 158.20 g/mol, XLogP of 1.31, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxobutan-2-yl butanoate is sourced from PubChem (CID 529253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).