C43H80NO10P — CID 52925377
(2S)-2-amino-3-[[(2R)-3-[(Z)-heptadec-9-enoyl]oxy-2-[(Z)-icos-11-enoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 52925377) has the molecular formula C43H80NO10P and a molecular weight of 802.08 g/mol. Its IUPAC name is (2S)-2-amino-3-[[(2R)-3-[(Z)-heptadec-9-enoyl]oxy-2-[(Z)-icos-11-enoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[[(2R)-3-[(Z)-heptadec-9-enoyl]oxy-2-[(Z)-icos-11-enoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 52925377 |
| Molecular Formula | C43H80NO10P |
| Molecular Weight | 802.08 g/mol |
| Exact Mass | 801.55 |
| IUPAC Name | (2S)-2-amino-3-[[(2R)-3-[(Z)-heptadec-9-enoyl]oxy-2-[(Z)-icos-11-enoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@H](N)C(=O)O)OC(=O)CCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C43H80NO10P/c1-3-5-7-9-11-13-15-17-19-20-21-23-25-27-29-31-33-35-42(46)54-39(37-52-55(49,50)53-38-40(44)43(47)48)36-51-41(45)34-32-30-28-26-24-22-18-16-14-12-10-8-6-4-2/h16-19,39-40H,3-15,20-38,44H2,1-2H3,(H,47,48)(H,49,50)/b18-16-,19-17-/t39-,40+/m1/s1 |
| InChIKey | ITLKAUPUYGJDON-NBWDJCFRSA-N |
| XLogP | 11.45 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.08 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|