C39H71O10P — CID 52926610
[(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(Z)-pentadec-9-enoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 52926610) has the molecular formula C39H71O10P and a molecular weight of 730.96 g/mol. Its IUPAC name is [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(Z)-pentadec-9-enoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(Z)-pentadec-9-enoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 52926610 |
| Molecular Formula | C39H71O10P |
| Molecular Weight | 730.96 g/mol |
| Exact Mass | 730.48 |
| IUPAC Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(Z)-pentadec-9-enoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)CO)OC(=O)CCCCCCC/C=C\CCCCC |
| InChI | InChI=1S/C39H71O10P/c1-3-5-7-9-11-13-15-17-18-19-21-22-24-26-28-30-38(42)46-34-37(35-48-50(44,45)47-33-36(41)32-40)49-39(43)31-29-27-25-23-20-16-14-12-10-8-6-4-2/h11-14,17-18,36-37,40-41H,3-10,15-16,19-35H2,1-2H3,(H,44,45)/b13-11-,14-12-,18-17-/t36-,37+/m0/s1 |
| InChIKey | ANPXFISVQYALFL-UBUYEQFGSA-N |
| XLogP | 9.61 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.96 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|