C38H71O8P — CID 52928919
[(2R)-2-[(Z)-heptadec-9-enoyl]oxy-3-phosphonooxypropyl] (Z)-octadec-9-enoate (PubChem CID 52928919) has the molecular formula C38H71O8P and a molecular weight of 686.95 g/mol. Its IUPAC name is [(2R)-2-[(Z)-heptadec-9-enoyl]oxy-3-phosphonooxypropyl] (Z)-octadec-9-enoate.
| Compound Name | [(2R)-2-[(Z)-heptadec-9-enoyl]oxy-3-phosphonooxypropyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 52928919 |
| Molecular Formula | C38H71O8P |
| Molecular Weight | 686.95 g/mol |
| Exact Mass | 686.49 |
| IUPAC Name | [(2R)-2-[(Z)-heptadec-9-enoyl]oxy-3-phosphonooxypropyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCC/C=C\CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C\CCCCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C38H71O8P/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-37(39)44-34-36(35-45-47(41,42)43)46-38(40)33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h16-19,36H,3-15,20-35H2,1-2H3,(H2,41,42,43)/b18-16-,19-17-/t36-/m1/s1 |
| InChIKey | KFJXBKXMZTWOBB-RVBXBWATSA-N |
| XLogP | 11.24 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.95 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|