About methyl 3-acetyloxyoctanoate
methyl 3-acetyloxyoctanoate (PubChem CID 529300) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is methyl 3-acetyloxyoctanoate.
Molecular Properties
| Compound Name | methyl 3-acetyloxyoctanoate |
| PubChem CID | 529300 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | methyl 3-acetyloxyoctanoate |
| SMILES | CCCCCC(CC(=O)OC)OC(C)=O |
| InChI | InChI=1S/C11H20O4/c1-4-5-6-7-10(15-9(2)12)8-11(13)14-3/h10H,4-8H2,1-3H3 |
| InChIKey | HGSORJXMRKICEG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-acetyloxyoctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-acetyloxyoctanoate?
The IUPAC name of methyl 3-acetyloxyoctanoate (CID 529300) is methyl 3-acetyloxyoctanoate.
What is the SMILES notation for methyl 3-acetyloxyoctanoate?
The canonical SMILES for methyl 3-acetyloxyoctanoate is CCCCCC(CC(=O)OC)OC(C)=O.
What is the InChIKey of methyl 3-acetyloxyoctanoate?
The InChIKey is HGSORJXMRKICEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-4-5-6-7-10(15-9(2)12)8-11(13)14-3/h10H,4-8H2,1-3H3.
What are the key properties of methyl 3-acetyloxyoctanoate?
methyl 3-acetyloxyoctanoate has a molecular weight of 216.28 g/mol, XLogP of 2.06, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-acetyloxyoctanoate is sourced from PubChem (CID 529300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).