C23H22F3N3O3 — CID 52932330
3-ethyl-1-[(1R)-1-[4-[1-oxo-2-(2,2,2-trifluoroethyl)-3H-isoindol-5-yl]phenyl]ethyl]imidazolidine-2,4-dione (PubChem CID 52932330) has the molecular formula C23H22F3N3O3 and a molecular weight of 445.44 g/mol. Its IUPAC name is 3-ethyl-1-[(1R)-1-[4-[1-oxo-2-(2,2,2-trifluoroethyl)-3H-isoindol-5-yl]phenyl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 3-ethyl-1-[(1R)-1-[4-[1-oxo-2-(2,2,2-trifluoroethyl)-3H-isoindol-5-yl]phenyl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 52932330 |
| Molecular Formula | C23H22F3N3O3 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 3-ethyl-1-[(1R)-1-[4-[1-oxo-2-(2,2,2-trifluoroethyl)-3H-isoindol-5-yl]phenyl]ethyl]imidazolidine-2,4-dione |
| SMILES | CCN1C(=O)CN([C@H](C)c2ccc(-c3ccc4c(c3)CN(CC(F)(F)F)C4=O)cc2)C1=O |
| InChI | InChI=1S/C23H22F3N3O3/c1-3-28-20(30)12-29(22(28)32)14(2)15-4-6-16(7-5-15)17-8-9-19-18(10-17)11-27(21(19)31)13-23(24,25)26/h4-10,14H,3,11-13H2,1-2H3/t14-/m1/s1 |
| InChIKey | NWSXGPSUHGGFDF-CQSZACIVSA-N |
| XLogP | 4.22 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|