C24H28F3N5O5S — CID 52932692
N-methyl-3-[[7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]-4-(2,2,2-trifluoroethoxy)benzenesulfonamide (PubChem CID 52932692) has the molecular formula C24H28F3N5O5S and a molecular weight of 555.58 g/mol. Its IUPAC name is N-methyl-3-[[7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]-4-(2,2,2-trifluoroethoxy)benzenesulfonamide.
| Compound Name | N-methyl-3-[[7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]-4-(2,2,2-trifluoroethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 52932692 |
| Molecular Formula | C24H28F3N5O5S |
| Molecular Weight | 555.58 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | N-methyl-3-[[7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]-4-(2,2,2-trifluoroethoxy)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(OCC(F)(F)F)c(Nc2ncnc3cc(OCCCN4CCOCC4)ccc23)c1 |
| InChI | InChI=1S/C24H28F3N5O5S/c1-28-38(33,34)18-4-6-22(37-15-24(25,26)27)21(14-18)31-23-19-5-3-17(13-20(19)29-16-30-23)36-10-2-7-32-8-11-35-12-9-32/h3-6,13-14,16,28H,2,7-12,15H2,1H3,(H,29,30,31) |
| InChIKey | BCPFKHJCHDHGPM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.58 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|