C28H28O5 — CID 52932813
(Z)-6-[(2S,4S,5R)-4-(2-hydroxyphenyl)-2-(2-phenylphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid (PubChem CID 52932813) has the molecular formula C28H28O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is (Z)-6-[(2S,4S,5R)-4-(2-hydroxyphenyl)-2-(2-phenylphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid.
| Compound Name | (Z)-6-[(2S,4S,5R)-4-(2-hydroxyphenyl)-2-(2-phenylphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 52932813 |
| Molecular Formula | C28H28O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | (Z)-6-[(2S,4S,5R)-4-(2-hydroxyphenyl)-2-(2-phenylphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
| SMILES | O=C(O)CC/C=C\C[C@@H]1CO[C@H](c2ccccc2-c2ccccc2)O[C@@H]1c1ccccc1O |
| InChI | InChI=1S/C28H28O5/c29-25-17-10-9-16-24(25)27-21(13-5-2-6-18-26(30)31)19-32-28(33-27)23-15-8-7-14-22(23)20-11-3-1-4-12-20/h1-5,7-12,14-17,21,27-29H,6,13,18-19H2,(H,30,31)/b5-2-/t21-,27+,28+/m1/s1 |
| InChIKey | BNQNWVVMSITUTR-LMZCSDHJSA-N |
| XLogP | 6.27 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|