C20H19FN8O2 — CID 52932891
methyl N-[4,6-diamino-2-[1-[(2,3,4,5-tetradeuterio-6-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]pyrimidin-5-yl]-N-(trideuteriomethyl)carbamate (PubChem CID 52932891) has the molecular formula C20H19FN8O2 and a molecular weight of 429.47 g/mol. Its IUPAC name is methyl N-[4,6-diamino-2-[1-[(2,3,4,5-tetradeuterio-6-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]pyrimidin-5-yl]-N-(trideuteriomethyl)carbamate.
| Compound Name | methyl N-[4,6-diamino-2-[1-[(2,3,4,5-tetradeuterio-6-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]pyrimidin-5-yl]-N-(trideuteriomethyl)carbamate |
|---|---|
| PubChem CID | 52932891 |
| Molecular Formula | C20H19FN8O2 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | methyl N-[4,6-diamino-2-[1-[(2,3,4,5-tetradeuterio-6-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]pyrimidin-5-yl]-N-(trideuteriomethyl)carbamate |
| SMILES | [2H]c1c([2H])c([2H])c(Cn2nc(-c3nc(N)c(N(C(=O)OC)C([2H])([2H])[2H])c(N)n3)c3cccnc32)c(F)c1[2H] |
| InChI | InChI=1S/C20H19FN8O2/c1-28(20(30)31-2)15-16(22)25-18(26-17(15)23)14-12-7-5-9-24-19(12)29(27-14)10-11-6-3-4-8-13(11)21/h3-9H,10H2,1-2H3,(H4,22,23,25,26)/i1D3,3D,4D,6D,8D |
| InChIKey | WXXSNCNJFUAIDG-IBIKLYTOSA-N |
| XLogP | 2.44 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |