C30H27Cl2F3N4O3 — CID 52932998
methyl 4-[[(2R,3S,4S,5S)-3-(3-chloro-2-fluorophenyl)-4-(5-chloro-3-fluoro-2-pyridinyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-fluorobenzoate (PubChem CID 52932998) has the molecular formula C30H27Cl2F3N4O3 and a molecular weight of 619.47 g/mol. Its IUPAC name is methyl 4-[[(2R,3S,4S,5S)-3-(3-chloro-2-fluorophenyl)-4-(5-chloro-3-fluoro-2-pyridinyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-fluorobenzoate.
| Compound Name | methyl 4-[[(2R,3S,4S,5S)-3-(3-chloro-2-fluorophenyl)-4-(5-chloro-3-fluoro-2-pyridinyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-fluorobenzoate |
|---|---|
| PubChem CID | 52932998 |
| Molecular Formula | C30H27Cl2F3N4O3 |
| Molecular Weight | 619.47 g/mol |
| Exact Mass | 618.14 |
| IUPAC Name | methyl 4-[[(2R,3S,4S,5S)-3-(3-chloro-2-fluorophenyl)-4-(5-chloro-3-fluoro-2-pyridinyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-fluorobenzoate |
| SMILES | COC(=O)c1ccc(NC(=O)[C@@H]2N[C@@H](CC(C)(C)C)[C@](C#N)(c3ncc(Cl)cc3F)[C@H]2c2cccc(Cl)c2F)c(F)c1 |
| InChI | InChI=1S/C30H27Cl2F3N4O3/c1-29(2,3)12-22-30(14-36,26-20(34)11-16(31)13-37-26)23(17-6-5-7-18(32)24(17)35)25(39-22)27(40)38-21-9-8-15(10-19(21)33)28(41)42-4/h5-11,13,22-23,25,39H,12H2,1-4H3,(H,38,40)/t22-,23-,25+,30-/m0/s1 |
| InChIKey | ISSLHDAYKORCOQ-UYJRMYGWSA-N |
| XLogP | 6.55 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.47 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |