About 2-[benzyl(methyl)amino]-4,6-dibromophenol
2-[benzyl(methyl)amino]-4,6-dibromophenol (PubChem CID 52933281) has the molecular formula C14H13Br2NO
and a molecular weight of 371.07 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]-4,6-dibromophenol.
Molecular Properties
| Compound Name | 2-[benzyl(methyl)amino]-4,6-dibromophenol |
| PubChem CID | 52933281 |
| Molecular Formula | C14H13Br2NO |
| Molecular Weight | 371.07 g/mol |
| Exact Mass | 368.94 |
| IUPAC Name | 2-[benzyl(methyl)amino]-4,6-dibromophenol |
| SMILES | CN(Cc1ccccc1)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C14H13Br2NO/c1-17(9-10-5-3-2-4-6-10)13-8-11(15)7-12(16)14(13)18/h2-8,18H,9H2,1H3 |
| InChIKey | CPSWTXDWEMCKKR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.07 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[benzyl(methyl)amino]-4,6-dibromophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[benzyl(methyl)amino]-4,6-dibromophenol?
The IUPAC name of 2-[benzyl(methyl)amino]-4,6-dibromophenol (CID 52933281) is 2-[benzyl(methyl)amino]-4,6-dibromophenol.
What is the SMILES notation for 2-[benzyl(methyl)amino]-4,6-dibromophenol?
The canonical SMILES for 2-[benzyl(methyl)amino]-4,6-dibromophenol is CN(Cc1ccccc1)c1cc(Br)cc(Br)c1O.
What is the InChIKey of 2-[benzyl(methyl)amino]-4,6-dibromophenol?
The InChIKey is CPSWTXDWEMCKKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Br2NO/c1-17(9-10-5-3-2-4-6-10)13-8-11(15)7-12(16)14(13)18/h2-8,18H,9H2,1H3.
What are the key properties of 2-[benzyl(methyl)amino]-4,6-dibromophenol?
2-[benzyl(methyl)amino]-4,6-dibromophenol has a molecular weight of 371.07 g/mol, XLogP of 4.55, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[benzyl(methyl)amino]-4,6-dibromophenol is sourced from PubChem (CID 52933281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).