C26H30N6O2 — CID 52933429
3-(1,4-diazepan-1-ylmethyl)-N-[(3-methoxyphenyl)methyl]-6-(1H-pyrazol-4-yl)-1H-indole-2-carboxamide (PubChem CID 52933429) has the molecular formula C26H30N6O2 and a molecular weight of 458.60 g/mol. Its IUPAC name is 3-(1,4-diazepan-1-ylmethyl)-N-[(3-methoxyphenyl)methyl]-6-(1H-pyrazol-4-yl)-1H-indole-2-carboxamide.
| Compound Name | 3-(1,4-diazepan-1-ylmethyl)-N-[(3-methoxyphenyl)methyl]-6-(1H-pyrazol-4-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 52933429 |
| Molecular Formula | C26H30N6O2 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 3-(1,4-diazepan-1-ylmethyl)-N-[(3-methoxyphenyl)methyl]-6-(1H-pyrazol-4-yl)-1H-indole-2-carboxamide |
| SMILES | COC1=CC=CC(=C1)CNC(=O)C2=C(C3=C(N2)C=C(C=C3)C4=CNN=C4)CN5CCCNCC5 |
| InChI | InChI=1S/C26H30N6O2/c1-34-21-5-2-4-18(12-21)14-28-26(33)25-23(17-32-10-3-8-27-9-11-32)22-7-6-19(13-24(22)31-25)20-15-29-30-16-20/h2,4-7,12-13,15-16,27,31H,3,8-11,14,17H2,1H3,(H,28,33)(H,29,30) |
| InChIKey | XQRURWYFVKRWAH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 98.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | 665 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|