C24H29NO2 — CID 52933742
(E)-3-[4-[methyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]phenyl]prop-2-enoic acid (PubChem CID 52933742) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is (E)-3-[4-[methyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[methyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 52933742 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (E)-3-[4-[methyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]phenyl]prop-2-enoic acid |
| SMILES | CN(c1ccc(/C=C/C(=O)O)cc1)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C24H29NO2/c1-23(2)14-15-24(3,4)21-16-19(11-12-20(21)23)25(5)18-9-6-17(7-10-18)8-13-22(26)27/h6-13,16H,14-15H2,1-5H3,(H,26,27)/b13-8+ |
| InChIKey | SXAYPHIBQQHRSK-MDWZMJQESA-N |
| XLogP | 5.90 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|