About 3-(4,6-dimethoxypyrimidin-2-yl)oxypyridin-2-amine
3-(4,6-dimethoxypyrimidin-2-yl)oxypyridin-2-amine (PubChem CID 52934007) has the molecular formula C11H12N4O3
and a molecular weight of 248.24 g/mol. Its IUPAC name is 3-(4,6-dimethoxypyrimidin-2-yl)oxypyridin-2-amine.
Molecular Properties
| Compound Name | 3-(4,6-dimethoxypyrimidin-2-yl)oxypyridin-2-amine |
| PubChem CID | 52934007 |
| Molecular Formula | C11H12N4O3 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 3-(4,6-dimethoxypyrimidin-2-yl)oxypyridin-2-amine |
| SMILES | COc1cc(OC)nc(Oc2cccnc2N)n1 |
| InChI | InChI=1S/C11H12N4O3/c1-16-8-6-9(17-2)15-11(14-8)18-7-4-3-5-13-10(7)12/h3-6H,1-2H3,(H2,12,13) |
| InChIKey | VWKFWDSPYAVUFA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 92.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(4,6-dimethoxypyrimidin-2-yl)oxypyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,6-dimethoxypyrimidin-2-yl)oxypyridin-2-amine?
The IUPAC name of 3-(4,6-dimethoxypyrimidin-2-yl)oxypyridin-2-amine (CID 52934007) is 3-(4,6-dimethoxypyrimidin-2-yl)oxypyridin-2-amine.
What is the SMILES notation for 3-(4,6-dimethoxypyrimidin-2-yl)oxypyridin-2-amine?
The canonical SMILES for 3-(4,6-dimethoxypyrimidin-2-yl)oxypyridin-2-amine is COc1cc(OC)nc(Oc2cccnc2N)n1.
What is the InChIKey of 3-(4,6-dimethoxypyrimidin-2-yl)oxypyridin-2-amine?
The InChIKey is VWKFWDSPYAVUFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O3/c1-16-8-6-9(17-2)15-11(14-8)18-7-4-3-5-13-10(7)12/h3-6H,1-2H3,(H2,12,13).
What are the key properties of 3-(4,6-dimethoxypyrimidin-2-yl)oxypyridin-2-amine?
3-(4,6-dimethoxypyrimidin-2-yl)oxypyridin-2-amine has a molecular weight of 248.24 g/mol, XLogP of 1.26, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,6-dimethoxypyrimidin-2-yl)oxypyridin-2-amine is sourced from PubChem (CID 52934007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).