About 3-methyl-3-propyloxetane
3-methyl-3-propyloxetane (PubChem CID 529341) has the molecular formula C7H14O
and a molecular weight of 114.19 g/mol. Its IUPAC name is 3-methyl-3-propyloxetane.
Molecular Properties
| Compound Name | 3-methyl-3-propyloxetane |
| PubChem CID | 529341 |
| Molecular Formula | C7H14O |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.10 |
| IUPAC Name | 3-methyl-3-propyloxetane |
| SMILES | CCCC1(C)COC1 |
| InChI | InChI=1S/C7H14O/c1-3-4-7(2)5-8-6-7/h3-6H2,1-2H3 |
| InChIKey | VMDLIHFPTHBGRM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-3-propyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3-propyloxetane?
The IUPAC name of 3-methyl-3-propyloxetane (CID 529341) is 3-methyl-3-propyloxetane.
What is the SMILES notation for 3-methyl-3-propyloxetane?
The canonical SMILES for 3-methyl-3-propyloxetane is CCCC1(C)COC1.
What is the InChIKey of 3-methyl-3-propyloxetane?
The InChIKey is VMDLIHFPTHBGRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O/c1-3-4-7(2)5-8-6-7/h3-6H2,1-2H3.
What are the key properties of 3-methyl-3-propyloxetane?
3-methyl-3-propyloxetane has a molecular weight of 114.19 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3-propyloxetane is sourced from PubChem (CID 529341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).