C34H52O — CID 52934533
(10R,13R,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-3-phenylmethoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 52934533) has the molecular formula C34H52O and a molecular weight of 476.79 g/mol. Its IUPAC name is (10R,13R,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-3-phenylmethoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (10R,13R,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-3-phenylmethoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 52934533 |
| Molecular Formula | C34H52O |
| Molecular Weight | 476.79 g/mol |
| Exact Mass | 476.40 |
| IUPAC Name | (10R,13R,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-3-phenylmethoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC(C)CCCC(C)[C@H]1CCC2C3CC=C4CC(OCc5ccccc5)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C34H52O/c1-24(2)10-9-11-25(3)30-16-17-31-29-15-14-27-22-28(35-23-26-12-7-6-8-13-26)18-20-33(27,4)32(29)19-21-34(30,31)5/h6-8,12-14,24-25,28-32H,9-11,15-23H2,1-5H3/t25?,28?,29?,30-,31?,32?,33+,34-/m1/s1 |
| InChIKey | WOOIMKQUXAEKBL-YFALUPSJSA-N |
| XLogP | 9.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.79 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|