About 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-methyl-1H-indazol-3-one
7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-methyl-1H-indazol-3-one (PubChem CID 52934580) has the molecular formula C22H18F2N2O3
and a molecular weight of 396.39 g/mol. Its IUPAC name is 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-methyl-1H-indazol-3-one.
Molecular Properties
| Compound Name | 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-methyl-1H-indazol-3-one |
| PubChem CID | 52934580 |
| Molecular Formula | C22H18F2N2O3 |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-methyl-1H-indazol-3-one |
| SMILES | COc1cc(F)c(F)cc1-c1ccc(OCc2cccc3c(=O)n(C)[nH]c23)cc1 |
| InChI | InChI=1S/C22H18F2N2O3/c1-26-22(27)16-5-3-4-14(21(16)25-26)12-29-15-8-6-13(7-9-15)17-10-18(23)19(24)11-20(17)28-2/h3-11,25H,12H2,1-2H3 |
| InChIKey | DMLIRYZFFKGTRV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|
Analyze 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-methyl-1H-indazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-methyl-1H-indazol-3-one?
The IUPAC name of 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-methyl-1H-indazol-3-one (CID 52934580) is 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-methyl-1H-indazol-3-one.
What is the SMILES notation for 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-methyl-1H-indazol-3-one?
The canonical SMILES for 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-methyl-1H-indazol-3-one is COc1cc(F)c(F)cc1-c1ccc(OCc2cccc3c(=O)n(C)[nH]c23)cc1.
What is the InChIKey of 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-methyl-1H-indazol-3-one?
The InChIKey is DMLIRYZFFKGTRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18F2N2O3/c1-26-22(27)16-5-3-4-14(21(16)25-26)12-29-15-8-6-13(7-9-15)17-10-18(23)19(24)11-20(17)28-2/h3-11,25H,12H2,1-2H3.
What are the key properties of 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-methyl-1H-indazol-3-one?
7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-methyl-1H-indazol-3-one has a molecular weight of 396.39 g/mol, XLogP of 4.40, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-methyl-1H-indazol-3-one is sourced from PubChem (CID 52934580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).