About 8-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-1-propyl-7H-purin-6-one
8-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-1-propyl-7H-purin-6-one (PubChem CID 52934614) has the molecular formula C20H22F2N4O2
and a molecular weight of 388.42 g/mol. Its IUPAC name is 8-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-1-propyl-7H-purin-6-one.
Molecular Properties
| Compound Name | 8-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-1-propyl-7H-purin-6-one |
| PubChem CID | 52934614 |
| Molecular Formula | C20H22F2N4O2 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 8-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-1-propyl-7H-purin-6-one |
| SMILES | CCCn1c(OCc2cc(F)cc(F)c2)nc2nc(C3CCCC3)[nH]c2c1=O |
| InChI | InChI=1S/C20H22F2N4O2/c1-2-7-26-19(27)16-18(24-17(23-16)13-5-3-4-6-13)25-20(26)28-11-12-8-14(21)10-15(22)9-12/h8-10,13H,2-7,11H2,1H3,(H,23,24) |
| InChIKey | WNGPJFNSJCTDCT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-1-propyl-7H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-1-propyl-7H-purin-6-one?
The IUPAC name of 8-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-1-propyl-7H-purin-6-one (CID 52934614) is 8-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-1-propyl-7H-purin-6-one.
What is the SMILES notation for 8-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-1-propyl-7H-purin-6-one?
The canonical SMILES for 8-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-1-propyl-7H-purin-6-one is CCCn1c(OCc2cc(F)cc(F)c2)nc2nc(C3CCCC3)[nH]c2c1=O.
What is the InChIKey of 8-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-1-propyl-7H-purin-6-one?
The InChIKey is WNGPJFNSJCTDCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22F2N4O2/c1-2-7-26-19(27)16-18(24-17(23-16)13-5-3-4-6-13)25-20(26)28-11-12-8-14(21)10-15(22)9-12/h8-10,13H,2-7,11H2,1H3,(H,23,24).
What are the key properties of 8-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-1-propyl-7H-purin-6-one?
8-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-1-propyl-7H-purin-6-one has a molecular weight of 388.42 g/mol, XLogP of 4.04, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-1-propyl-7H-purin-6-one is sourced from PubChem (CID 52934614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).