C10H10Br4N4 — CID 52934640
N'-(4,5,6,7-tetrabromo-1-methylbenzimidazol-2-yl)ethane-1,2-diamine (PubChem CID 52934640) has the molecular formula C10H10Br4N4 and a molecular weight of 505.83 g/mol. Its IUPAC name is N'-(4,5,6,7-tetrabromo-1-methylbenzimidazol-2-yl)ethane-1,2-diamine.
| Compound Name | N'-(4,5,6,7-tetrabromo-1-methylbenzimidazol-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 52934640 |
| Molecular Formula | C10H10Br4N4 |
| Molecular Weight | 505.83 g/mol |
| Exact Mass | 501.76 |
| IUPAC Name | N'-(4,5,6,7-tetrabromo-1-methylbenzimidazol-2-yl)ethane-1,2-diamine |
| SMILES | Cn1c(NCCN)nc2c(Br)c(Br)c(Br)c(Br)c21 |
| InChI | InChI=1S/C10H10Br4N4/c1-18-9-7(14)5(12)4(11)6(13)8(9)17-10(18)16-3-2-15/h2-3,15H2,1H3,(H,16,17) |
| InChIKey | DVPOGZSIQGTDSK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.83 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|