C21H27N5O4 — CID 52934884
3-[6-(2-hydroxypropan-2-yl)-1-oxidopyridin-1-ium-3-yl]-5-(4-methoxycyclohexyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one (PubChem CID 52934884) has the molecular formula C21H27N5O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is 3-[6-(2-hydroxypropan-2-yl)-1-oxidopyridin-1-ium-3-yl]-5-(4-methoxycyclohexyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one.
| Compound Name | 3-[6-(2-hydroxypropan-2-yl)-1-oxidopyridin-1-ium-3-yl]-5-(4-methoxycyclohexyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one |
|---|---|
| PubChem CID | 52934884 |
| Molecular Formula | C21H27N5O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 3-[6-(2-hydroxypropan-2-yl)-1-oxidopyridin-1-ium-3-yl]-5-(4-methoxycyclohexyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one |
| SMILES | COC1CCC(N2C(=O)CNc3ncc(-c4ccc(C(C)(C)O)[n+]([O-])c4)nc32)CC1 |
| InChI | InChI=1S/C21H27N5O4/c1-21(2,28)17-9-4-13(12-25(17)29)16-10-22-19-20(24-16)26(18(27)11-23-19)14-5-7-15(30-3)8-6-14/h4,9-10,12,14-15,28H,5-8,11H2,1-3H3,(H,22,23) |
| InChIKey | XTQFYGUDDGJCCH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 114.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|