C22H19F5O5 — CID 52934895
(Z)-6-[(2S,4S,5R)-4-(2-hydroxyphenyl)-2-(2,3,4,5,6-pentafluorophenyl)-1,3-dioxan-5-yl]hex-4-enoic acid (PubChem CID 52934895) has the molecular formula C22H19F5O5 and a molecular weight of 458.38 g/mol. Its IUPAC name is (Z)-6-[(2S,4S,5R)-4-(2-hydroxyphenyl)-2-(2,3,4,5,6-pentafluorophenyl)-1,3-dioxan-5-yl]hex-4-enoic acid.
| Compound Name | (Z)-6-[(2S,4S,5R)-4-(2-hydroxyphenyl)-2-(2,3,4,5,6-pentafluorophenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 52934895 |
| Molecular Formula | C22H19F5O5 |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | (Z)-6-[(2S,4S,5R)-4-(2-hydroxyphenyl)-2-(2,3,4,5,6-pentafluorophenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
| SMILES | O=C(O)CC/C=C\C[C@@H]1CO[C@H](c2c(F)c(F)c(F)c(F)c2F)O[C@@H]1c1ccccc1O |
| InChI | InChI=1S/C22H19F5O5/c23-16-15(17(24)19(26)20(27)18(16)25)22-31-10-11(6-2-1-3-9-14(29)30)21(32-22)12-7-4-5-8-13(12)28/h1-2,4-5,7-8,11,21-22,28H,3,6,9-10H2,(H,29,30)/b2-1-/t11-,21+,22+/m1/s1 |
| InChIKey | HJWACACSAZUELA-MZLZUJQESA-N |
| XLogP | 5.30 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|