About CID 52934986
CID 52934986 (PubChem CID 52934986) has the molecular formula C12H22NO2
and a molecular weight of 212.31 g/mol.
Molecular Properties
| Compound Name | CID 52934986 |
| PubChem CID | 52934986 |
| Molecular Formula | C12H22NO2 |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.17 |
| IUPAC Name | — |
| SMILES | CCCCC1(C)CC(=O)CC(C)(C)N1[O] |
| InChI | InChI=1S/C12H22NO2/c1-5-6-7-12(4)9-10(14)8-11(2,3)13(12)15/h5-9H2,1-4H3 |
| InChIKey | VFVXPHNMQMIGEV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 52934986 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 52934986?
The IUPAC name of CID 52934986 (CID 52934986) is not available.
What is the SMILES notation for CID 52934986?
The canonical SMILES for CID 52934986 is CCCCC1(C)CC(=O)CC(C)(C)N1[O].
What is the InChIKey of CID 52934986?
The InChIKey is VFVXPHNMQMIGEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22NO2/c1-5-6-7-12(4)9-10(14)8-11(2,3)13(12)15/h5-9H2,1-4H3.
What are the key properties of CID 52934986?
CID 52934986 has a molecular weight of 212.31 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 52934986 is sourced from PubChem (CID 52934986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).