About 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-(4-fluorophenyl)-1H-indazol-3-one
7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-(4-fluorophenyl)-1H-indazol-3-one (PubChem CID 52935035) has the molecular formula C27H19F3N2O3
and a molecular weight of 476.45 g/mol. Its IUPAC name is 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-(4-fluorophenyl)-1H-indazol-3-one.
Molecular Properties
| Compound Name | 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-(4-fluorophenyl)-1H-indazol-3-one |
| PubChem CID | 52935035 |
| Molecular Formula | C27H19F3N2O3 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-(4-fluorophenyl)-1H-indazol-3-one |
| SMILES | COc1cc(F)c(F)cc1-c1ccc(OCc2cccc3c(=O)n(-c4ccc(F)cc4)[nH]c23)cc1 |
| InChI | InChI=1S/C27H19F3N2O3/c1-34-25-14-24(30)23(29)13-22(25)16-5-11-20(12-6-16)35-15-17-3-2-4-21-26(17)31-32(27(21)33)19-9-7-18(28)8-10-19/h2-14,31H,15H2,1H3 |
| InChIKey | YHHCWMFXAPBEKN-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|
Analyze 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-(4-fluorophenyl)-1H-indazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-(4-fluorophenyl)-1H-indazol-3-one?
The IUPAC name of 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-(4-fluorophenyl)-1H-indazol-3-one (CID 52935035) is 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-(4-fluorophenyl)-1H-indazol-3-one.
What is the SMILES notation for 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-(4-fluorophenyl)-1H-indazol-3-one?
The canonical SMILES for 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-(4-fluorophenyl)-1H-indazol-3-one is COc1cc(F)c(F)cc1-c1ccc(OCc2cccc3c(=O)n(-c4ccc(F)cc4)[nH]c23)cc1.
What is the InChIKey of 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-(4-fluorophenyl)-1H-indazol-3-one?
The InChIKey is YHHCWMFXAPBEKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H19F3N2O3/c1-34-25-14-24(30)23(29)13-22(25)16-5-11-20(12-6-16)35-15-17-3-2-4-21-26(17)31-32(27(21)33)19-9-7-18(28)8-10-19/h2-14,31H,15H2,1H3.
What are the key properties of 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-(4-fluorophenyl)-1H-indazol-3-one?
7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-(4-fluorophenyl)-1H-indazol-3-one has a molecular weight of 476.45 g/mol, XLogP of 5.99, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-2-(4-fluorophenyl)-1H-indazol-3-one is sourced from PubChem (CID 52935035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).