C17H19F3O5 — CID 52935119
(Z)-6-[(2S,4S,5R)-4-(2-hydroxyphenyl)-2-(trifluoromethyl)-1,3-dioxan-5-yl]hex-4-enoic acid (PubChem CID 52935119) has the molecular formula C17H19F3O5 and a molecular weight of 360.33 g/mol. Its IUPAC name is (Z)-6-[(2S,4S,5R)-4-(2-hydroxyphenyl)-2-(trifluoromethyl)-1,3-dioxan-5-yl]hex-4-enoic acid.
| Compound Name | (Z)-6-[(2S,4S,5R)-4-(2-hydroxyphenyl)-2-(trifluoromethyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 52935119 |
| Molecular Formula | C17H19F3O5 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (Z)-6-[(2S,4S,5R)-4-(2-hydroxyphenyl)-2-(trifluoromethyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
| SMILES | O=C(O)CC/C=C\C[C@@H]1CO[C@H](C(F)(F)F)O[C@@H]1c1ccccc1O |
| InChI | InChI=1S/C17H19F3O5/c18-17(19,20)16-24-10-11(6-2-1-3-9-14(22)23)15(25-16)12-7-4-5-8-13(12)21/h1-2,4-5,7-8,11,15-16,21H,3,6,9-10H2,(H,22,23)/b2-1-/t11-,15+,16+/m1/s1 |
| InChIKey | ANFRHKJQTNHGIC-LARHIVTESA-N |
| XLogP | 3.80 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|