About [3-(trifluoromethyl)phenyl]methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate
[3-(trifluoromethyl)phenyl]methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate (PubChem CID 52935517) has the molecular formula C18H15F3N2O2
and a molecular weight of 348.32 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | [3-(trifluoromethyl)phenyl]methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate |
| PubChem CID | 52935517 |
| Molecular Formula | C18H15F3N2O2 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate |
| SMILES | Cc1ccn2c(C(=O)OCc3cccc(C(F)(F)F)c3)c(C)nc2c1 |
| InChI | InChI=1S/C18H15F3N2O2/c1-11-6-7-23-15(8-11)22-12(2)16(23)17(24)25-10-13-4-3-5-14(9-13)18(19,20)21/h3-9H,10H2,1-2H3 |
| InChIKey | SGTCFUACBUNUFP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(trifluoromethyl)phenyl]methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(trifluoromethyl)phenyl]methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate?
The IUPAC name of [3-(trifluoromethyl)phenyl]methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate (CID 52935517) is [3-(trifluoromethyl)phenyl]methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate.
What is the SMILES notation for [3-(trifluoromethyl)phenyl]methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate?
The canonical SMILES for [3-(trifluoromethyl)phenyl]methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate is Cc1ccn2c(C(=O)OCc3cccc(C(F)(F)F)c3)c(C)nc2c1.
What is the InChIKey of [3-(trifluoromethyl)phenyl]methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate?
The InChIKey is SGTCFUACBUNUFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F3N2O2/c1-11-6-7-23-15(8-11)22-12(2)16(23)17(24)25-10-13-4-3-5-14(9-13)18(19,20)21/h3-9H,10H2,1-2H3.
What are the key properties of [3-(trifluoromethyl)phenyl]methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate?
[3-(trifluoromethyl)phenyl]methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate has a molecular weight of 348.32 g/mol, XLogP of 4.33, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(trifluoromethyl)phenyl]methyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate is sourced from PubChem (CID 52935517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).