About 2,6-dimethylheptan-4-yl 4-[(4-hydroxy-3-methoxyphenyl)methylcarbamoyl]piperidine-1-carboxylate
2,6-dimethylheptan-4-yl 4-[(4-hydroxy-3-methoxyphenyl)methylcarbamoyl]piperidine-1-carboxylate (PubChem CID 52935557) has the molecular formula C24H38N2O5
and a molecular weight of 434.58 g/mol. Its IUPAC name is 2,6-dimethylheptan-4-yl 4-[(4-hydroxy-3-methoxyphenyl)methylcarbamoyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | 2,6-dimethylheptan-4-yl 4-[(4-hydroxy-3-methoxyphenyl)methylcarbamoyl]piperidine-1-carboxylate |
| PubChem CID | 52935557 |
| Molecular Formula | C24H38N2O5 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 2,6-dimethylheptan-4-yl 4-[(4-hydroxy-3-methoxyphenyl)methylcarbamoyl]piperidine-1-carboxylate |
| SMILES | COc1cc(CNC(=O)C2CCN(C(=O)OC(CC(C)C)CC(C)C)CC2)ccc1O |
| InChI | InChI=1S/C24H38N2O5/c1-16(2)12-20(13-17(3)4)31-24(29)26-10-8-19(9-11-26)23(28)25-15-18-6-7-21(27)22(14-18)30-5/h6-7,14,16-17,19-20,27H,8-13,15H2,1-5H3,(H,25,28) |
| InChIKey | XWHMRWLJASKGMU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,6-dimethylheptan-4-yl 4-[(4-hydroxy-3-methoxyphenyl)methylcarbamoyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylheptan-4-yl 4-[(4-hydroxy-3-methoxyphenyl)methylcarbamoyl]piperidine-1-carboxylate?
The IUPAC name of 2,6-dimethylheptan-4-yl 4-[(4-hydroxy-3-methoxyphenyl)methylcarbamoyl]piperidine-1-carboxylate (CID 52935557) is 2,6-dimethylheptan-4-yl 4-[(4-hydroxy-3-methoxyphenyl)methylcarbamoyl]piperidine-1-carboxylate.
What is the SMILES notation for 2,6-dimethylheptan-4-yl 4-[(4-hydroxy-3-methoxyphenyl)methylcarbamoyl]piperidine-1-carboxylate?
The canonical SMILES for 2,6-dimethylheptan-4-yl 4-[(4-hydroxy-3-methoxyphenyl)methylcarbamoyl]piperidine-1-carboxylate is COc1cc(CNC(=O)C2CCN(C(=O)OC(CC(C)C)CC(C)C)CC2)ccc1O.
What is the InChIKey of 2,6-dimethylheptan-4-yl 4-[(4-hydroxy-3-methoxyphenyl)methylcarbamoyl]piperidine-1-carboxylate?
The InChIKey is XWHMRWLJASKGMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H38N2O5/c1-16(2)12-20(13-17(3)4)31-24(29)26-10-8-19(9-11-26)23(28)25-15-18-6-7-21(27)22(14-18)30-5/h6-7,14,16-17,19-20,27H,8-13,15H2,1-5H3,(H,25,28).
What are the key properties of 2,6-dimethylheptan-4-yl 4-[(4-hydroxy-3-methoxyphenyl)methylcarbamoyl]piperidine-1-carboxylate?
2,6-dimethylheptan-4-yl 4-[(4-hydroxy-3-methoxyphenyl)methylcarbamoyl]piperidine-1-carboxylate has a molecular weight of 434.58 g/mol, XLogP of 4.33, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylheptan-4-yl 4-[(4-hydroxy-3-methoxyphenyl)methylcarbamoyl]piperidine-1-carboxylate is sourced from PubChem (CID 52935557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).