C18H16Br4N4 — CID 52935608
1-benzyl-4,5,6,7-tetrabromo-2-piperazin-1-ylbenzimidazole (PubChem CID 52935608) has the molecular formula C18H16Br4N4 and a molecular weight of 607.97 g/mol. Its IUPAC name is 1-benzyl-4,5,6,7-tetrabromo-2-piperazin-1-ylbenzimidazole.
| Compound Name | 1-benzyl-4,5,6,7-tetrabromo-2-piperazin-1-ylbenzimidazole |
|---|---|
| PubChem CID | 52935608 |
| Molecular Formula | C18H16Br4N4 |
| Molecular Weight | 607.97 g/mol |
| Exact Mass | 603.81 |
| IUPAC Name | 1-benzyl-4,5,6,7-tetrabromo-2-piperazin-1-ylbenzimidazole |
| SMILES | Brc1c(Br)c(Br)c2c(nc(N3CCNCC3)n2Cc2ccccc2)c1Br |
| InChI | InChI=1S/C18H16Br4N4/c19-12-13(20)15(22)17-16(14(12)21)24-18(25-8-6-23-7-9-25)26(17)10-11-4-2-1-3-5-11/h1-5,23H,6-10H2 |
| InChIKey | RJPCMGQQJFFYQO-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.97 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|