C30H29Cl2FN4O3 — CID 52936195
methyl 4-[[(2R,3S,4S,5S)-3-(3-chloro-2-fluorophenyl)-4-(5-chloro-2-pyridinyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]benzoate (PubChem CID 52936195) has the molecular formula C30H29Cl2FN4O3 and a molecular weight of 583.49 g/mol. Its IUPAC name is methyl 4-[[(2R,3S,4S,5S)-3-(3-chloro-2-fluorophenyl)-4-(5-chloro-2-pyridinyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[(2R,3S,4S,5S)-3-(3-chloro-2-fluorophenyl)-4-(5-chloro-2-pyridinyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 52936195 |
| Molecular Formula | C30H29Cl2FN4O3 |
| Molecular Weight | 583.49 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | methyl 4-[[(2R,3S,4S,5S)-3-(3-chloro-2-fluorophenyl)-4-(5-chloro-2-pyridinyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)[C@@H]2N[C@@H](CC(C)(C)C)[C@](C#N)(c3ccc(Cl)cn3)[C@H]2c2cccc(Cl)c2F)cc1 |
| InChI | InChI=1S/C30H29Cl2FN4O3/c1-29(2,3)14-23-30(16-34,22-13-10-18(31)15-35-22)24(20-6-5-7-21(32)25(20)33)26(37-23)27(38)36-19-11-8-17(9-12-19)28(39)40-4/h5-13,15,23-24,26,37H,14H2,1-4H3,(H,36,38)/t23-,24-,26+,30-/m0/s1 |
| InChIKey | YGEUSVFHKDOZQW-FQFMIMTMSA-N |
| XLogP | 6.27 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.49 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |