C19H29NO3 — CID 52936664
methyl (4R,6R,8S,13S)-8,13-dimethyl-9-oxo-6-propan-2-yl-3-azatricyclo[6.4.1.04,13]tridec-1(12)-ene-3-carboxylate (PubChem CID 52936664) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is methyl (4R,6R,8S,13S)-8,13-dimethyl-9-oxo-6-propan-2-yl-3-azatricyclo[6.4.1.04,13]tridec-1(12)-ene-3-carboxylate.
| Compound Name | methyl (4R,6R,8S,13S)-8,13-dimethyl-9-oxo-6-propan-2-yl-3-azatricyclo[6.4.1.04,13]tridec-1(12)-ene-3-carboxylate |
|---|---|
| PubChem CID | 52936664 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | methyl (4R,6R,8S,13S)-8,13-dimethyl-9-oxo-6-propan-2-yl-3-azatricyclo[6.4.1.04,13]tridec-1(12)-ene-3-carboxylate |
| SMILES | COC(=O)N1CC2=CCCC(=O)[C@@]3(C)C[C@@H](C(C)C)C[C@@H]1[C@@]23C |
| InChI | InChI=1S/C19H29NO3/c1-12(2)13-9-15-19(4)14(11-20(15)17(22)23-5)7-6-8-16(21)18(19,3)10-13/h7,12-13,15H,6,8-11H2,1-5H3/t13-,15+,18+,19+/m0/s1 |
| InChIKey | GBDKVIBVCLPVNC-LLBUTXAOSA-N |
| XLogP | 3.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|