About 4-[(1E,4E)-5-[4-(dimethylamino)phenyl]-3-oxopenta-1,4-dienyl]benzoic acid
4-[(1E,4E)-5-[4-(dimethylamino)phenyl]-3-oxopenta-1,4-dienyl]benzoic acid (PubChem CID 52936701) has the molecular formula C20H19NO3
and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-[(1E,4E)-5-[4-(dimethylamino)phenyl]-3-oxopenta-1,4-dienyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[(1E,4E)-5-[4-(dimethylamino)phenyl]-3-oxopenta-1,4-dienyl]benzoic acid |
| PubChem CID | 52936701 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 4-[(1E,4E)-5-[4-(dimethylamino)phenyl]-3-oxopenta-1,4-dienyl]benzoic acid |
| SMILES | CN(C)c1ccc(/C=C/C(=O)/C=C/c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H19NO3/c1-21(2)18-11-5-16(6-12-18)8-14-19(22)13-7-15-3-9-17(10-4-15)20(23)24/h3-14H,1-2H3,(H,23,24)/b13-7+,14-8+ |
| InChIKey | PWARUXTVJIUXHS-FNCQTZNRSA-N |
| XLogP | 3.75 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1E,4E)-5-[4-(dimethylamino)phenyl]-3-oxopenta-1,4-dienyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1E,4E)-5-[4-(dimethylamino)phenyl]-3-oxopenta-1,4-dienyl]benzoic acid?
The IUPAC name of 4-[(1E,4E)-5-[4-(dimethylamino)phenyl]-3-oxopenta-1,4-dienyl]benzoic acid (CID 52936701) is 4-[(1E,4E)-5-[4-(dimethylamino)phenyl]-3-oxopenta-1,4-dienyl]benzoic acid.
What is the SMILES notation for 4-[(1E,4E)-5-[4-(dimethylamino)phenyl]-3-oxopenta-1,4-dienyl]benzoic acid?
The canonical SMILES for 4-[(1E,4E)-5-[4-(dimethylamino)phenyl]-3-oxopenta-1,4-dienyl]benzoic acid is CN(C)c1ccc(/C=C/C(=O)/C=C/c2ccc(C(=O)O)cc2)cc1.
What is the InChIKey of 4-[(1E,4E)-5-[4-(dimethylamino)phenyl]-3-oxopenta-1,4-dienyl]benzoic acid?
The InChIKey is PWARUXTVJIUXHS-FNCQTZNRSA-N. The full InChI is InChI=1S/C20H19NO3/c1-21(2)18-11-5-16(6-12-18)8-14-19(22)13-7-15-3-9-17(10-4-15)20(23)24/h3-14H,1-2H3,(H,23,24)/b13-7+,14-8+.
What are the key properties of 4-[(1E,4E)-5-[4-(dimethylamino)phenyl]-3-oxopenta-1,4-dienyl]benzoic acid?
4-[(1E,4E)-5-[4-(dimethylamino)phenyl]-3-oxopenta-1,4-dienyl]benzoic acid has a molecular weight of 321.38 g/mol, XLogP of 3.75, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1E,4E)-5-[4-(dimethylamino)phenyl]-3-oxopenta-1,4-dienyl]benzoic acid is sourced from PubChem (CID 52936701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).