C30H36O2 — CID 52936820
[(2S,3aS,6aR)-5-hexyl-6-phenyl-6a-(1-phenylethenyl)-2,3,3a,4-tetrahydro-1H-pentalen-2-yl] acetate (PubChem CID 52936820) has the molecular formula C30H36O2 and a molecular weight of 428.62 g/mol. Its IUPAC name is [(2S,3aS,6aR)-5-hexyl-6-phenyl-6a-(1-phenylethenyl)-2,3,3a,4-tetrahydro-1H-pentalen-2-yl] acetate.
| Compound Name | [(2S,3aS,6aR)-5-hexyl-6-phenyl-6a-(1-phenylethenyl)-2,3,3a,4-tetrahydro-1H-pentalen-2-yl] acetate |
|---|---|
| PubChem CID | 52936820 |
| Molecular Formula | C30H36O2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | [(2S,3aS,6aR)-5-hexyl-6-phenyl-6a-(1-phenylethenyl)-2,3,3a,4-tetrahydro-1H-pentalen-2-yl] acetate |
| SMILES | C=C(c1ccccc1)[C@@]12C[C@@H](OC(C)=O)C[C@@H]1CC(CCCCCC)=C2c1ccccc1 |
| InChI | InChI=1S/C30H36O2/c1-4-5-6-9-18-26-19-27-20-28(32-23(3)31)21-30(27,22(2)24-14-10-7-11-15-24)29(26)25-16-12-8-13-17-25/h7-8,10-17,27-28H,2,4-6,9,18-21H2,1,3H3/t27-,28-,30-/m0/s1 |
| InChIKey | QULCFEHAJUKZHR-XEVVZDEMSA-N |
| XLogP | 7.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|