About 2-bromoethyl 1-(3-fluoro-4-phenylphenyl)cyclopropane-1-carboxylate
2-bromoethyl 1-(3-fluoro-4-phenylphenyl)cyclopropane-1-carboxylate (PubChem CID 52936828) has the molecular formula C18H16BrFO2
and a molecular weight of 363.23 g/mol. Its IUPAC name is 2-bromoethyl 1-(3-fluoro-4-phenylphenyl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | 2-bromoethyl 1-(3-fluoro-4-phenylphenyl)cyclopropane-1-carboxylate |
| PubChem CID | 52936828 |
| Molecular Formula | C18H16BrFO2 |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 2-bromoethyl 1-(3-fluoro-4-phenylphenyl)cyclopropane-1-carboxylate |
| SMILES | O=C(OCCBr)C1(c2ccc(-c3ccccc3)c(F)c2)CC1 |
| InChI | InChI=1S/C18H16BrFO2/c19-10-11-22-17(21)18(8-9-18)14-6-7-15(16(20)12-14)13-4-2-1-3-5-13/h1-7,12H,8-11H2 |
| InChIKey | PJQOIRSAUOBCTD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoethyl 1-(3-fluoro-4-phenylphenyl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoethyl 1-(3-fluoro-4-phenylphenyl)cyclopropane-1-carboxylate?
The IUPAC name of 2-bromoethyl 1-(3-fluoro-4-phenylphenyl)cyclopropane-1-carboxylate (CID 52936828) is 2-bromoethyl 1-(3-fluoro-4-phenylphenyl)cyclopropane-1-carboxylate.
What is the SMILES notation for 2-bromoethyl 1-(3-fluoro-4-phenylphenyl)cyclopropane-1-carboxylate?
The canonical SMILES for 2-bromoethyl 1-(3-fluoro-4-phenylphenyl)cyclopropane-1-carboxylate is O=C(OCCBr)C1(c2ccc(-c3ccccc3)c(F)c2)CC1.
What is the InChIKey of 2-bromoethyl 1-(3-fluoro-4-phenylphenyl)cyclopropane-1-carboxylate?
The InChIKey is PJQOIRSAUOBCTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16BrFO2/c19-10-11-22-17(21)18(8-9-18)14-6-7-15(16(20)12-14)13-4-2-1-3-5-13/h1-7,12H,8-11H2.
What are the key properties of 2-bromoethyl 1-(3-fluoro-4-phenylphenyl)cyclopropane-1-carboxylate?
2-bromoethyl 1-(3-fluoro-4-phenylphenyl)cyclopropane-1-carboxylate has a molecular weight of 363.23 g/mol, XLogP of 4.46, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoethyl 1-(3-fluoro-4-phenylphenyl)cyclopropane-1-carboxylate is sourced from PubChem (CID 52936828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).