About 2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) pyrrolidine-1,2-dicarboxylate
2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) pyrrolidine-1,2-dicarboxylate (PubChem CID 529369) has the molecular formula C16H31NO4Si
and a molecular weight of 329.51 g/mol. Its IUPAC name is 2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) pyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) pyrrolidine-1,2-dicarboxylate |
| PubChem CID | 529369 |
| Molecular Formula | C16H31NO4Si |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)COC(=O)N1CCCC1C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H31NO4Si/c1-12(2)11-20-15(19)17-10-8-9-13(17)14(18)21-22(6,7)16(3,4)5/h12-13H,8-11H2,1-7H3 |
| InChIKey | SXOFCRXOJZTZKC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) pyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) pyrrolidine-1,2-dicarboxylate?
The IUPAC name of 2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) pyrrolidine-1,2-dicarboxylate (CID 529369) is 2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) pyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for 2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) pyrrolidine-1,2-dicarboxylate?
The canonical SMILES for 2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) pyrrolidine-1,2-dicarboxylate is CC(C)COC(=O)N1CCCC1C(=O)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of 2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) pyrrolidine-1,2-dicarboxylate?
The InChIKey is SXOFCRXOJZTZKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO4Si/c1-12(2)11-20-15(19)17-10-8-9-13(17)14(18)21-22(6,7)16(3,4)5/h12-13H,8-11H2,1-7H3.
What are the key properties of 2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) pyrrolidine-1,2-dicarboxylate?
2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) pyrrolidine-1,2-dicarboxylate has a molecular weight of 329.51 g/mol, XLogP of 3.79, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) pyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 529369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).