C26H38O — CID 52936934
(3aR,6aS)-6a-cyclohexyloxy-5-hexyl-6-phenyl-2,3,3a,4-tetrahydro-1H-pentalene (PubChem CID 52936934) has the molecular formula C26H38O and a molecular weight of 366.59 g/mol. Its IUPAC name is (3aR,6aS)-6a-cyclohexyloxy-5-hexyl-6-phenyl-2,3,3a,4-tetrahydro-1H-pentalene.
| Compound Name | (3aR,6aS)-6a-cyclohexyloxy-5-hexyl-6-phenyl-2,3,3a,4-tetrahydro-1H-pentalene |
|---|---|
| PubChem CID | 52936934 |
| Molecular Formula | C26H38O |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.29 |
| IUPAC Name | (3aR,6aS)-6a-cyclohexyloxy-5-hexyl-6-phenyl-2,3,3a,4-tetrahydro-1H-pentalene |
| SMILES | CCCCCCC1=C(c2ccccc2)[C@]2(OC3CCCCC3)CCC[C@@H]2C1 |
| InChI | InChI=1S/C26H38O/c1-2-3-4-7-15-22-20-23-16-12-19-26(23,27-24-17-10-6-11-18-24)25(22)21-13-8-5-9-14-21/h5,8-9,13-14,23-24H,2-4,6-7,10-12,15-20H2,1H3/t23-,26+/m1/s1 |
| InChIKey | OJGKQCGEXWAXEK-BVAGGSTKSA-N |
| XLogP | 7.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|