C19H17Cl2NO — CID 52937027
(1E,4E)-1-(2,6-dichlorophenyl)-5-[4-(dimethylamino)phenyl]penta-1,4-dien-3-one (PubChem CID 52937027) has the molecular formula C19H17Cl2NO and a molecular weight of 346.26 g/mol. Its IUPAC name is (1E,4E)-1-(2,6-dichlorophenyl)-5-[4-(dimethylamino)phenyl]penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-(2,6-dichlorophenyl)-5-[4-(dimethylamino)phenyl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 52937027 |
| Molecular Formula | C19H17Cl2NO |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | (1E,4E)-1-(2,6-dichlorophenyl)-5-[4-(dimethylamino)phenyl]penta-1,4-dien-3-one |
| SMILES | CN(C)c1ccc(/C=C/C(=O)/C=C/c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C19H17Cl2NO/c1-22(2)15-9-6-14(7-10-15)8-11-16(23)12-13-17-18(20)4-3-5-19(17)21/h3-13H,1-2H3/b11-8+,13-12+ |
| InChIKey | NCICXPOOXMAYED-OWKCIBLPSA-N |
| XLogP | 5.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|